- Add live camera QR scanner for nsec/ncryptsec login - Replace browser prompt() with proper password dialog for ncryptsec - Add missing /notes/:id route for thread view navigation - Remove explore section entirely (button, page, routes) - Remove profile button from bottom nav, avatar now opens profile - Remove "Notes" tab from feed, default to showing all posts/replies - Add PasswordPromptProvider for secure password input - Add SidebarDrawer for mobile navigation - Add domain layer with value objects and adapters - Various UI and navigation improvements 🤖 Generated with [Claude Code](https://claude.com/claude-code) Co-Authored-By: Claude Opus 4.5 <noreply@anthropic.com>
635 lines
14 KiB
Markdown
635 lines
14 KiB
Markdown
---
|
|
name: applesauce-core
|
|
description: This skill should be used when working with applesauce-core library for Nostr client development, including event stores, queries, observables, and client utilities. Provides comprehensive knowledge of applesauce patterns for building reactive Nostr applications.
|
|
---
|
|
|
|
# applesauce-core Skill
|
|
|
|
This skill provides comprehensive knowledge and patterns for working with applesauce-core, a library that provides reactive utilities and patterns for building Nostr clients.
|
|
|
|
## When to Use This Skill
|
|
|
|
Use this skill when:
|
|
- Building reactive Nostr applications
|
|
- Managing event stores and caches
|
|
- Working with observable patterns for Nostr
|
|
- Implementing real-time updates
|
|
- Building timeline and feed views
|
|
- Managing replaceable events
|
|
- Working with profiles and metadata
|
|
- Creating efficient Nostr queries
|
|
|
|
## Core Concepts
|
|
|
|
### applesauce-core Overview
|
|
|
|
applesauce-core provides:
|
|
- **Event stores** - Reactive event caching and management
|
|
- **Queries** - Declarative event querying patterns
|
|
- **Observables** - RxJS-based reactive patterns
|
|
- **Profile helpers** - Profile metadata management
|
|
- **Timeline utilities** - Feed and timeline building
|
|
- **NIP helpers** - NIP-specific utilities
|
|
|
|
### Installation
|
|
|
|
```bash
|
|
npm install applesauce-core
|
|
```
|
|
|
|
### Basic Architecture
|
|
|
|
applesauce-core is built on reactive principles:
|
|
- Events are stored in reactive stores
|
|
- Queries return observables that update when new events arrive
|
|
- Components subscribe to observables for real-time updates
|
|
|
|
## Event Store
|
|
|
|
### Creating an Event Store
|
|
|
|
```javascript
|
|
import { EventStore } from 'applesauce-core';
|
|
|
|
// Create event store
|
|
const eventStore = new EventStore();
|
|
|
|
// Add events
|
|
eventStore.add(event1);
|
|
eventStore.add(event2);
|
|
|
|
// Add multiple events
|
|
eventStore.addMany([event1, event2, event3]);
|
|
|
|
// Check if event exists
|
|
const exists = eventStore.has(eventId);
|
|
|
|
// Get event by ID
|
|
const event = eventStore.get(eventId);
|
|
|
|
// Remove event
|
|
eventStore.remove(eventId);
|
|
|
|
// Clear all events
|
|
eventStore.clear();
|
|
```
|
|
|
|
### Event Store Queries
|
|
|
|
```javascript
|
|
// Get all events
|
|
const allEvents = eventStore.getAll();
|
|
|
|
// Get events by filter
|
|
const filtered = eventStore.filter({
|
|
kinds: [1],
|
|
authors: [pubkey]
|
|
});
|
|
|
|
// Get events by author
|
|
const authorEvents = eventStore.getByAuthor(pubkey);
|
|
|
|
// Get events by kind
|
|
const textNotes = eventStore.getByKind(1);
|
|
```
|
|
|
|
### Replaceable Events
|
|
|
|
applesauce-core handles replaceable events automatically:
|
|
|
|
```javascript
|
|
// For kind 0 (profile), only latest is kept
|
|
eventStore.add(profileEvent1); // stored
|
|
eventStore.add(profileEvent2); // replaces if newer
|
|
|
|
// For parameterized replaceable (30000-39999)
|
|
eventStore.add(articleEvent); // keyed by author + kind + d-tag
|
|
|
|
// Get replaceable event
|
|
const profile = eventStore.getReplaceable(0, pubkey);
|
|
const article = eventStore.getReplaceable(30023, pubkey, 'article-slug');
|
|
```
|
|
|
|
## Queries
|
|
|
|
### Query Patterns
|
|
|
|
```javascript
|
|
import { createQuery } from 'applesauce-core';
|
|
|
|
// Create a query
|
|
const query = createQuery(eventStore, {
|
|
kinds: [1],
|
|
limit: 50
|
|
});
|
|
|
|
// Subscribe to query results
|
|
query.subscribe(events => {
|
|
console.log('Current events:', events);
|
|
});
|
|
|
|
// Query updates automatically when new events added
|
|
eventStore.add(newEvent); // Subscribers notified
|
|
```
|
|
|
|
### Timeline Query
|
|
|
|
```javascript
|
|
import { TimelineQuery } from 'applesauce-core';
|
|
|
|
// Create timeline for user's notes
|
|
const timeline = new TimelineQuery(eventStore, {
|
|
kinds: [1],
|
|
authors: [userPubkey]
|
|
});
|
|
|
|
// Get observable of timeline
|
|
const timeline$ = timeline.events$;
|
|
|
|
// Subscribe
|
|
timeline$.subscribe(events => {
|
|
// Events sorted by created_at, newest first
|
|
renderTimeline(events);
|
|
});
|
|
```
|
|
|
|
### Profile Query
|
|
|
|
```javascript
|
|
import { ProfileQuery } from 'applesauce-core';
|
|
|
|
// Query profile metadata
|
|
const profileQuery = new ProfileQuery(eventStore, pubkey);
|
|
|
|
// Get observable
|
|
const profile$ = profileQuery.profile$;
|
|
|
|
profile$.subscribe(profile => {
|
|
if (profile) {
|
|
console.log('Name:', profile.name);
|
|
console.log('Picture:', profile.picture);
|
|
}
|
|
});
|
|
```
|
|
|
|
## Observables
|
|
|
|
### Working with RxJS
|
|
|
|
applesauce-core uses RxJS observables:
|
|
|
|
```javascript
|
|
import { map, filter, distinctUntilChanged } from 'rxjs/operators';
|
|
|
|
// Transform query results
|
|
const names$ = profileQuery.profile$.pipe(
|
|
filter(profile => profile !== null),
|
|
map(profile => profile.name),
|
|
distinctUntilChanged()
|
|
);
|
|
|
|
// Combine multiple observables
|
|
import { combineLatest } from 'rxjs';
|
|
|
|
const combined$ = combineLatest([
|
|
timeline$,
|
|
profile$
|
|
]).pipe(
|
|
map(([events, profile]) => ({
|
|
events,
|
|
authorName: profile?.name
|
|
}))
|
|
);
|
|
```
|
|
|
|
### Creating Custom Observables
|
|
|
|
```javascript
|
|
import { Observable } from 'rxjs';
|
|
|
|
function createEventObservable(store, filter) {
|
|
return new Observable(subscriber => {
|
|
// Initial emit
|
|
subscriber.next(store.filter(filter));
|
|
|
|
// Subscribe to store changes
|
|
const unsubscribe = store.onChange(() => {
|
|
subscriber.next(store.filter(filter));
|
|
});
|
|
|
|
// Cleanup
|
|
return () => unsubscribe();
|
|
});
|
|
}
|
|
```
|
|
|
|
## Profile Helpers
|
|
|
|
### Profile Metadata
|
|
|
|
```javascript
|
|
import { parseProfile, ProfileContent } from 'applesauce-core';
|
|
|
|
// Parse kind 0 content
|
|
const profileEvent = await getProfileEvent(pubkey);
|
|
const profile = parseProfile(profileEvent);
|
|
|
|
// Profile fields
|
|
console.log(profile.name); // Display name
|
|
console.log(profile.about); // Bio
|
|
console.log(profile.picture); // Avatar URL
|
|
console.log(profile.banner); // Banner image URL
|
|
console.log(profile.nip05); // NIP-05 identifier
|
|
console.log(profile.lud16); // Lightning address
|
|
console.log(profile.website); // Website URL
|
|
```
|
|
|
|
### Profile Store
|
|
|
|
```javascript
|
|
import { ProfileStore } from 'applesauce-core';
|
|
|
|
const profileStore = new ProfileStore(eventStore);
|
|
|
|
// Get profile observable
|
|
const profile$ = profileStore.getProfile(pubkey);
|
|
|
|
// Get multiple profiles
|
|
const profiles$ = profileStore.getProfiles([pubkey1, pubkey2]);
|
|
|
|
// Request profile load (triggers fetch if not cached)
|
|
profileStore.requestProfile(pubkey);
|
|
```
|
|
|
|
## Timeline Utilities
|
|
|
|
### Building Feeds
|
|
|
|
```javascript
|
|
import { Timeline } from 'applesauce-core';
|
|
|
|
// Create timeline
|
|
const timeline = new Timeline(eventStore);
|
|
|
|
// Add filter
|
|
timeline.setFilter({
|
|
kinds: [1, 6],
|
|
authors: followedPubkeys
|
|
});
|
|
|
|
// Get events observable
|
|
const events$ = timeline.events$;
|
|
|
|
// Load more (pagination)
|
|
timeline.loadMore(50);
|
|
|
|
// Refresh (get latest)
|
|
timeline.refresh();
|
|
```
|
|
|
|
### Thread Building
|
|
|
|
```javascript
|
|
import { ThreadBuilder } from 'applesauce-core';
|
|
|
|
// Build thread from root event
|
|
const thread = new ThreadBuilder(eventStore, rootEventId);
|
|
|
|
// Get thread observable
|
|
const thread$ = thread.thread$;
|
|
|
|
thread$.subscribe(threadData => {
|
|
console.log('Root:', threadData.root);
|
|
console.log('Replies:', threadData.replies);
|
|
console.log('Reply count:', threadData.replyCount);
|
|
});
|
|
```
|
|
|
|
### Reactions and Zaps
|
|
|
|
```javascript
|
|
import { ReactionStore, ZapStore } from 'applesauce-core';
|
|
|
|
// Reactions
|
|
const reactionStore = new ReactionStore(eventStore);
|
|
const reactions$ = reactionStore.getReactions(eventId);
|
|
|
|
reactions$.subscribe(reactions => {
|
|
console.log('Likes:', reactions.likes);
|
|
console.log('Custom:', reactions.custom);
|
|
});
|
|
|
|
// Zaps
|
|
const zapStore = new ZapStore(eventStore);
|
|
const zaps$ = zapStore.getZaps(eventId);
|
|
|
|
zaps$.subscribe(zaps => {
|
|
console.log('Total sats:', zaps.totalAmount);
|
|
console.log('Zap count:', zaps.count);
|
|
});
|
|
```
|
|
|
|
## NIP Helpers
|
|
|
|
### NIP-05 Verification
|
|
|
|
```javascript
|
|
import { verifyNip05 } from 'applesauce-core';
|
|
|
|
// Verify NIP-05
|
|
const result = await verifyNip05('alice@example.com', expectedPubkey);
|
|
|
|
if (result.valid) {
|
|
console.log('NIP-05 verified');
|
|
} else {
|
|
console.log('Verification failed:', result.error);
|
|
}
|
|
```
|
|
|
|
### NIP-10 Reply Parsing
|
|
|
|
```javascript
|
|
import { parseReplyTags } from 'applesauce-core';
|
|
|
|
// Parse reply structure
|
|
const parsed = parseReplyTags(event);
|
|
|
|
console.log('Root event:', parsed.root);
|
|
console.log('Reply to:', parsed.reply);
|
|
console.log('Mentions:', parsed.mentions);
|
|
```
|
|
|
|
### NIP-65 Relay Lists
|
|
|
|
```javascript
|
|
import { parseRelayList } from 'applesauce-core';
|
|
|
|
// Parse relay list event (kind 10002)
|
|
const relays = parseRelayList(relayListEvent);
|
|
|
|
console.log('Read relays:', relays.read);
|
|
console.log('Write relays:', relays.write);
|
|
```
|
|
|
|
## Integration with nostr-tools
|
|
|
|
### Using with SimplePool
|
|
|
|
```javascript
|
|
import { SimplePool } from 'nostr-tools';
|
|
import { EventStore } from 'applesauce-core';
|
|
|
|
const pool = new SimplePool();
|
|
const eventStore = new EventStore();
|
|
|
|
// Load events into store
|
|
pool.subscribeMany(relays, [filter], {
|
|
onevent(event) {
|
|
eventStore.add(event);
|
|
}
|
|
});
|
|
|
|
// Query store reactively
|
|
const timeline$ = createTimelineQuery(eventStore, filter);
|
|
```
|
|
|
|
### Publishing Events
|
|
|
|
```javascript
|
|
import { finalizeEvent } from 'nostr-tools';
|
|
|
|
// Create event
|
|
const event = finalizeEvent({
|
|
kind: 1,
|
|
content: 'Hello!',
|
|
created_at: Math.floor(Date.now() / 1000),
|
|
tags: []
|
|
}, secretKey);
|
|
|
|
// Add to local store immediately (optimistic update)
|
|
eventStore.add(event);
|
|
|
|
// Publish to relays
|
|
await pool.publish(relays, event);
|
|
```
|
|
|
|
## Svelte Integration
|
|
|
|
### Using in Svelte Components
|
|
|
|
```svelte
|
|
<script>
|
|
import { onMount, onDestroy } from 'svelte';
|
|
import { EventStore, TimelineQuery } from 'applesauce-core';
|
|
|
|
export let pubkey;
|
|
|
|
const eventStore = new EventStore();
|
|
let events = [];
|
|
let subscription;
|
|
|
|
onMount(() => {
|
|
const timeline = new TimelineQuery(eventStore, {
|
|
kinds: [1],
|
|
authors: [pubkey]
|
|
});
|
|
|
|
subscription = timeline.events$.subscribe(e => {
|
|
events = e;
|
|
});
|
|
});
|
|
|
|
onDestroy(() => {
|
|
subscription?.unsubscribe();
|
|
});
|
|
</script>
|
|
|
|
{#each events as event}
|
|
<div class="event">
|
|
{event.content}
|
|
</div>
|
|
{/each}
|
|
```
|
|
|
|
### Svelte Store Adapter
|
|
|
|
```javascript
|
|
import { readable } from 'svelte/store';
|
|
|
|
// Convert RxJS observable to Svelte store
|
|
function fromObservable(observable, initialValue) {
|
|
return readable(initialValue, set => {
|
|
const subscription = observable.subscribe(set);
|
|
return () => subscription.unsubscribe();
|
|
});
|
|
}
|
|
|
|
// Usage
|
|
const events$ = timeline.events$;
|
|
const eventsStore = fromObservable(events$, []);
|
|
```
|
|
|
|
```svelte
|
|
<script>
|
|
import { eventsStore } from './stores.js';
|
|
</script>
|
|
|
|
{#each $eventsStore as event}
|
|
<div>{event.content}</div>
|
|
{/each}
|
|
```
|
|
|
|
## Best Practices
|
|
|
|
### Store Management
|
|
|
|
1. **Single store instance** - Use one EventStore per app
|
|
2. **Clear stale data** - Implement cache limits
|
|
3. **Handle replaceable events** - Let store manage deduplication
|
|
4. **Unsubscribe** - Clean up subscriptions on component destroy
|
|
|
|
### Query Optimization
|
|
|
|
1. **Use specific filters** - Narrow queries perform better
|
|
2. **Limit results** - Use limit for initial loads
|
|
3. **Cache queries** - Reuse query instances
|
|
4. **Debounce updates** - Throttle rapid changes
|
|
|
|
### Memory Management
|
|
|
|
1. **Limit store size** - Implement LRU or time-based eviction
|
|
2. **Clean up observables** - Unsubscribe when done
|
|
3. **Use weak references** - For profile caches
|
|
4. **Paginate large feeds** - Don't load everything at once
|
|
|
|
### Reactive Patterns
|
|
|
|
1. **Prefer observables** - Over imperative queries
|
|
2. **Use operators** - Transform data with RxJS
|
|
3. **Combine streams** - For complex views
|
|
4. **Handle loading states** - Show placeholders
|
|
|
|
## Common Patterns
|
|
|
|
### Event Deduplication
|
|
|
|
```javascript
|
|
// EventStore handles deduplication automatically
|
|
eventStore.add(event1);
|
|
eventStore.add(event1); // No duplicate
|
|
|
|
// For manual deduplication
|
|
const seen = new Set();
|
|
events.filter(e => {
|
|
if (seen.has(e.id)) return false;
|
|
seen.add(e.id);
|
|
return true;
|
|
});
|
|
```
|
|
|
|
### Optimistic Updates
|
|
|
|
```javascript
|
|
async function publishNote(content) {
|
|
// Create event
|
|
const event = await createEvent(content);
|
|
|
|
// Add to store immediately (optimistic)
|
|
eventStore.add(event);
|
|
|
|
try {
|
|
// Publish to relays
|
|
await pool.publish(relays, event);
|
|
} catch (error) {
|
|
// Remove on failure
|
|
eventStore.remove(event.id);
|
|
throw error;
|
|
}
|
|
}
|
|
```
|
|
|
|
### Loading States
|
|
|
|
```javascript
|
|
import { BehaviorSubject, combineLatest } from 'rxjs';
|
|
|
|
const loading$ = new BehaviorSubject(true);
|
|
const events$ = timeline.events$;
|
|
|
|
const state$ = combineLatest([loading$, events$]).pipe(
|
|
map(([loading, events]) => ({
|
|
loading,
|
|
events,
|
|
empty: !loading && events.length === 0
|
|
}))
|
|
);
|
|
|
|
// Start loading
|
|
loading$.next(true);
|
|
await loadEvents();
|
|
loading$.next(false);
|
|
```
|
|
|
|
### Infinite Scroll
|
|
|
|
```javascript
|
|
function createInfiniteScroll(timeline, pageSize = 50) {
|
|
let loading = false;
|
|
|
|
async function loadMore() {
|
|
if (loading) return;
|
|
|
|
loading = true;
|
|
await timeline.loadMore(pageSize);
|
|
loading = false;
|
|
}
|
|
|
|
function onScroll(event) {
|
|
const { scrollTop, scrollHeight, clientHeight } = event.target;
|
|
if (scrollHeight - scrollTop <= clientHeight * 1.5) {
|
|
loadMore();
|
|
}
|
|
}
|
|
|
|
return { loadMore, onScroll };
|
|
}
|
|
```
|
|
|
|
## Troubleshooting
|
|
|
|
### Common Issues
|
|
|
|
**Events not updating:**
|
|
- Check subscription is active
|
|
- Verify events are being added to store
|
|
- Ensure filter matches events
|
|
|
|
**Memory growing:**
|
|
- Implement store size limits
|
|
- Clean up subscriptions
|
|
- Use weak references where appropriate
|
|
|
|
**Slow queries:**
|
|
- Add indexes for common queries
|
|
- Use more specific filters
|
|
- Implement pagination
|
|
|
|
**Stale data:**
|
|
- Implement refresh mechanisms
|
|
- Set up real-time subscriptions
|
|
- Handle replaceable event updates
|
|
|
|
## References
|
|
|
|
- **applesauce GitHub**: https://github.com/hzrd149/applesauce
|
|
- **RxJS Documentation**: https://rxjs.dev
|
|
- **nostr-tools**: https://github.com/nbd-wtf/nostr-tools
|
|
- **Nostr Protocol**: https://github.com/nostr-protocol/nostr
|
|
|
|
## Related Skills
|
|
|
|
- **nostr-tools** - Lower-level Nostr operations
|
|
- **applesauce-signers** - Event signing abstractions
|
|
- **svelte** - Building reactive UIs
|
|
- **nostr** - Nostr protocol fundamentals
|