Rename project from Gooti to Plebian Signer and add Claude Code config
- Rename all gooti-* files to plebian-signer-* across Chrome and Firefox - Rename GootiMetaHandler to SignerMetaHandler in common library - Update all references to use new naming convention - Add CLAUDE.md with project build/architecture documentation - Add Claude Code release command tailored for this npm/Angular project - Add NWC-IMPLEMENTATION.md design document - Add Claude skills for nostr, typescript, react, svelte, and applesauce libs - Update README and various component templates with new branding 🤖 Generated with [Claude Code](https://claude.com/claude-code) Co-Authored-By: Claude Opus 4.5 <noreply@anthropic.com>
This commit is contained in:
634
.claude/skills/applesauce-core/SKILL.md
Normal file
634
.claude/skills/applesauce-core/SKILL.md
Normal file
@@ -0,0 +1,634 @@
|
||||
---
|
||||
name: applesauce-core
|
||||
description: This skill should be used when working with applesauce-core library for Nostr client development, including event stores, queries, observables, and client utilities. Provides comprehensive knowledge of applesauce patterns for building reactive Nostr applications.
|
||||
---
|
||||
|
||||
# applesauce-core Skill
|
||||
|
||||
This skill provides comprehensive knowledge and patterns for working with applesauce-core, a library that provides reactive utilities and patterns for building Nostr clients.
|
||||
|
||||
## When to Use This Skill
|
||||
|
||||
Use this skill when:
|
||||
- Building reactive Nostr applications
|
||||
- Managing event stores and caches
|
||||
- Working with observable patterns for Nostr
|
||||
- Implementing real-time updates
|
||||
- Building timeline and feed views
|
||||
- Managing replaceable events
|
||||
- Working with profiles and metadata
|
||||
- Creating efficient Nostr queries
|
||||
|
||||
## Core Concepts
|
||||
|
||||
### applesauce-core Overview
|
||||
|
||||
applesauce-core provides:
|
||||
- **Event stores** - Reactive event caching and management
|
||||
- **Queries** - Declarative event querying patterns
|
||||
- **Observables** - RxJS-based reactive patterns
|
||||
- **Profile helpers** - Profile metadata management
|
||||
- **Timeline utilities** - Feed and timeline building
|
||||
- **NIP helpers** - NIP-specific utilities
|
||||
|
||||
### Installation
|
||||
|
||||
```bash
|
||||
npm install applesauce-core
|
||||
```
|
||||
|
||||
### Basic Architecture
|
||||
|
||||
applesauce-core is built on reactive principles:
|
||||
- Events are stored in reactive stores
|
||||
- Queries return observables that update when new events arrive
|
||||
- Components subscribe to observables for real-time updates
|
||||
|
||||
## Event Store
|
||||
|
||||
### Creating an Event Store
|
||||
|
||||
```javascript
|
||||
import { EventStore } from 'applesauce-core';
|
||||
|
||||
// Create event store
|
||||
const eventStore = new EventStore();
|
||||
|
||||
// Add events
|
||||
eventStore.add(event1);
|
||||
eventStore.add(event2);
|
||||
|
||||
// Add multiple events
|
||||
eventStore.addMany([event1, event2, event3]);
|
||||
|
||||
// Check if event exists
|
||||
const exists = eventStore.has(eventId);
|
||||
|
||||
// Get event by ID
|
||||
const event = eventStore.get(eventId);
|
||||
|
||||
// Remove event
|
||||
eventStore.remove(eventId);
|
||||
|
||||
// Clear all events
|
||||
eventStore.clear();
|
||||
```
|
||||
|
||||
### Event Store Queries
|
||||
|
||||
```javascript
|
||||
// Get all events
|
||||
const allEvents = eventStore.getAll();
|
||||
|
||||
// Get events by filter
|
||||
const filtered = eventStore.filter({
|
||||
kinds: [1],
|
||||
authors: [pubkey]
|
||||
});
|
||||
|
||||
// Get events by author
|
||||
const authorEvents = eventStore.getByAuthor(pubkey);
|
||||
|
||||
// Get events by kind
|
||||
const textNotes = eventStore.getByKind(1);
|
||||
```
|
||||
|
||||
### Replaceable Events
|
||||
|
||||
applesauce-core handles replaceable events automatically:
|
||||
|
||||
```javascript
|
||||
// For kind 0 (profile), only latest is kept
|
||||
eventStore.add(profileEvent1); // stored
|
||||
eventStore.add(profileEvent2); // replaces if newer
|
||||
|
||||
// For parameterized replaceable (30000-39999)
|
||||
eventStore.add(articleEvent); // keyed by author + kind + d-tag
|
||||
|
||||
// Get replaceable event
|
||||
const profile = eventStore.getReplaceable(0, pubkey);
|
||||
const article = eventStore.getReplaceable(30023, pubkey, 'article-slug');
|
||||
```
|
||||
|
||||
## Queries
|
||||
|
||||
### Query Patterns
|
||||
|
||||
```javascript
|
||||
import { createQuery } from 'applesauce-core';
|
||||
|
||||
// Create a query
|
||||
const query = createQuery(eventStore, {
|
||||
kinds: [1],
|
||||
limit: 50
|
||||
});
|
||||
|
||||
// Subscribe to query results
|
||||
query.subscribe(events => {
|
||||
console.log('Current events:', events);
|
||||
});
|
||||
|
||||
// Query updates automatically when new events added
|
||||
eventStore.add(newEvent); // Subscribers notified
|
||||
```
|
||||
|
||||
### Timeline Query
|
||||
|
||||
```javascript
|
||||
import { TimelineQuery } from 'applesauce-core';
|
||||
|
||||
// Create timeline for user's notes
|
||||
const timeline = new TimelineQuery(eventStore, {
|
||||
kinds: [1],
|
||||
authors: [userPubkey]
|
||||
});
|
||||
|
||||
// Get observable of timeline
|
||||
const timeline$ = timeline.events$;
|
||||
|
||||
// Subscribe
|
||||
timeline$.subscribe(events => {
|
||||
// Events sorted by created_at, newest first
|
||||
renderTimeline(events);
|
||||
});
|
||||
```
|
||||
|
||||
### Profile Query
|
||||
|
||||
```javascript
|
||||
import { ProfileQuery } from 'applesauce-core';
|
||||
|
||||
// Query profile metadata
|
||||
const profileQuery = new ProfileQuery(eventStore, pubkey);
|
||||
|
||||
// Get observable
|
||||
const profile$ = profileQuery.profile$;
|
||||
|
||||
profile$.subscribe(profile => {
|
||||
if (profile) {
|
||||
console.log('Name:', profile.name);
|
||||
console.log('Picture:', profile.picture);
|
||||
}
|
||||
});
|
||||
```
|
||||
|
||||
## Observables
|
||||
|
||||
### Working with RxJS
|
||||
|
||||
applesauce-core uses RxJS observables:
|
||||
|
||||
```javascript
|
||||
import { map, filter, distinctUntilChanged } from 'rxjs/operators';
|
||||
|
||||
// Transform query results
|
||||
const names$ = profileQuery.profile$.pipe(
|
||||
filter(profile => profile !== null),
|
||||
map(profile => profile.name),
|
||||
distinctUntilChanged()
|
||||
);
|
||||
|
||||
// Combine multiple observables
|
||||
import { combineLatest } from 'rxjs';
|
||||
|
||||
const combined$ = combineLatest([
|
||||
timeline$,
|
||||
profile$
|
||||
]).pipe(
|
||||
map(([events, profile]) => ({
|
||||
events,
|
||||
authorName: profile?.name
|
||||
}))
|
||||
);
|
||||
```
|
||||
|
||||
### Creating Custom Observables
|
||||
|
||||
```javascript
|
||||
import { Observable } from 'rxjs';
|
||||
|
||||
function createEventObservable(store, filter) {
|
||||
return new Observable(subscriber => {
|
||||
// Initial emit
|
||||
subscriber.next(store.filter(filter));
|
||||
|
||||
// Subscribe to store changes
|
||||
const unsubscribe = store.onChange(() => {
|
||||
subscriber.next(store.filter(filter));
|
||||
});
|
||||
|
||||
// Cleanup
|
||||
return () => unsubscribe();
|
||||
});
|
||||
}
|
||||
```
|
||||
|
||||
## Profile Helpers
|
||||
|
||||
### Profile Metadata
|
||||
|
||||
```javascript
|
||||
import { parseProfile, ProfileContent } from 'applesauce-core';
|
||||
|
||||
// Parse kind 0 content
|
||||
const profileEvent = await getProfileEvent(pubkey);
|
||||
const profile = parseProfile(profileEvent);
|
||||
|
||||
// Profile fields
|
||||
console.log(profile.name); // Display name
|
||||
console.log(profile.about); // Bio
|
||||
console.log(profile.picture); // Avatar URL
|
||||
console.log(profile.banner); // Banner image URL
|
||||
console.log(profile.nip05); // NIP-05 identifier
|
||||
console.log(profile.lud16); // Lightning address
|
||||
console.log(profile.website); // Website URL
|
||||
```
|
||||
|
||||
### Profile Store
|
||||
|
||||
```javascript
|
||||
import { ProfileStore } from 'applesauce-core';
|
||||
|
||||
const profileStore = new ProfileStore(eventStore);
|
||||
|
||||
// Get profile observable
|
||||
const profile$ = profileStore.getProfile(pubkey);
|
||||
|
||||
// Get multiple profiles
|
||||
const profiles$ = profileStore.getProfiles([pubkey1, pubkey2]);
|
||||
|
||||
// Request profile load (triggers fetch if not cached)
|
||||
profileStore.requestProfile(pubkey);
|
||||
```
|
||||
|
||||
## Timeline Utilities
|
||||
|
||||
### Building Feeds
|
||||
|
||||
```javascript
|
||||
import { Timeline } from 'applesauce-core';
|
||||
|
||||
// Create timeline
|
||||
const timeline = new Timeline(eventStore);
|
||||
|
||||
// Add filter
|
||||
timeline.setFilter({
|
||||
kinds: [1, 6],
|
||||
authors: followedPubkeys
|
||||
});
|
||||
|
||||
// Get events observable
|
||||
const events$ = timeline.events$;
|
||||
|
||||
// Load more (pagination)
|
||||
timeline.loadMore(50);
|
||||
|
||||
// Refresh (get latest)
|
||||
timeline.refresh();
|
||||
```
|
||||
|
||||
### Thread Building
|
||||
|
||||
```javascript
|
||||
import { ThreadBuilder } from 'applesauce-core';
|
||||
|
||||
// Build thread from root event
|
||||
const thread = new ThreadBuilder(eventStore, rootEventId);
|
||||
|
||||
// Get thread observable
|
||||
const thread$ = thread.thread$;
|
||||
|
||||
thread$.subscribe(threadData => {
|
||||
console.log('Root:', threadData.root);
|
||||
console.log('Replies:', threadData.replies);
|
||||
console.log('Reply count:', threadData.replyCount);
|
||||
});
|
||||
```
|
||||
|
||||
### Reactions and Zaps
|
||||
|
||||
```javascript
|
||||
import { ReactionStore, ZapStore } from 'applesauce-core';
|
||||
|
||||
// Reactions
|
||||
const reactionStore = new ReactionStore(eventStore);
|
||||
const reactions$ = reactionStore.getReactions(eventId);
|
||||
|
||||
reactions$.subscribe(reactions => {
|
||||
console.log('Likes:', reactions.likes);
|
||||
console.log('Custom:', reactions.custom);
|
||||
});
|
||||
|
||||
// Zaps
|
||||
const zapStore = new ZapStore(eventStore);
|
||||
const zaps$ = zapStore.getZaps(eventId);
|
||||
|
||||
zaps$.subscribe(zaps => {
|
||||
console.log('Total sats:', zaps.totalAmount);
|
||||
console.log('Zap count:', zaps.count);
|
||||
});
|
||||
```
|
||||
|
||||
## NIP Helpers
|
||||
|
||||
### NIP-05 Verification
|
||||
|
||||
```javascript
|
||||
import { verifyNip05 } from 'applesauce-core';
|
||||
|
||||
// Verify NIP-05
|
||||
const result = await verifyNip05('alice@example.com', expectedPubkey);
|
||||
|
||||
if (result.valid) {
|
||||
console.log('NIP-05 verified');
|
||||
} else {
|
||||
console.log('Verification failed:', result.error);
|
||||
}
|
||||
```
|
||||
|
||||
### NIP-10 Reply Parsing
|
||||
|
||||
```javascript
|
||||
import { parseReplyTags } from 'applesauce-core';
|
||||
|
||||
// Parse reply structure
|
||||
const parsed = parseReplyTags(event);
|
||||
|
||||
console.log('Root event:', parsed.root);
|
||||
console.log('Reply to:', parsed.reply);
|
||||
console.log('Mentions:', parsed.mentions);
|
||||
```
|
||||
|
||||
### NIP-65 Relay Lists
|
||||
|
||||
```javascript
|
||||
import { parseRelayList } from 'applesauce-core';
|
||||
|
||||
// Parse relay list event (kind 10002)
|
||||
const relays = parseRelayList(relayListEvent);
|
||||
|
||||
console.log('Read relays:', relays.read);
|
||||
console.log('Write relays:', relays.write);
|
||||
```
|
||||
|
||||
## Integration with nostr-tools
|
||||
|
||||
### Using with SimplePool
|
||||
|
||||
```javascript
|
||||
import { SimplePool } from 'nostr-tools';
|
||||
import { EventStore } from 'applesauce-core';
|
||||
|
||||
const pool = new SimplePool();
|
||||
const eventStore = new EventStore();
|
||||
|
||||
// Load events into store
|
||||
pool.subscribeMany(relays, [filter], {
|
||||
onevent(event) {
|
||||
eventStore.add(event);
|
||||
}
|
||||
});
|
||||
|
||||
// Query store reactively
|
||||
const timeline$ = createTimelineQuery(eventStore, filter);
|
||||
```
|
||||
|
||||
### Publishing Events
|
||||
|
||||
```javascript
|
||||
import { finalizeEvent } from 'nostr-tools';
|
||||
|
||||
// Create event
|
||||
const event = finalizeEvent({
|
||||
kind: 1,
|
||||
content: 'Hello!',
|
||||
created_at: Math.floor(Date.now() / 1000),
|
||||
tags: []
|
||||
}, secretKey);
|
||||
|
||||
// Add to local store immediately (optimistic update)
|
||||
eventStore.add(event);
|
||||
|
||||
// Publish to relays
|
||||
await pool.publish(relays, event);
|
||||
```
|
||||
|
||||
## Svelte Integration
|
||||
|
||||
### Using in Svelte Components
|
||||
|
||||
```svelte
|
||||
<script>
|
||||
import { onMount, onDestroy } from 'svelte';
|
||||
import { EventStore, TimelineQuery } from 'applesauce-core';
|
||||
|
||||
export let pubkey;
|
||||
|
||||
const eventStore = new EventStore();
|
||||
let events = [];
|
||||
let subscription;
|
||||
|
||||
onMount(() => {
|
||||
const timeline = new TimelineQuery(eventStore, {
|
||||
kinds: [1],
|
||||
authors: [pubkey]
|
||||
});
|
||||
|
||||
subscription = timeline.events$.subscribe(e => {
|
||||
events = e;
|
||||
});
|
||||
});
|
||||
|
||||
onDestroy(() => {
|
||||
subscription?.unsubscribe();
|
||||
});
|
||||
</script>
|
||||
|
||||
{#each events as event}
|
||||
<div class="event">
|
||||
{event.content}
|
||||
</div>
|
||||
{/each}
|
||||
```
|
||||
|
||||
### Svelte Store Adapter
|
||||
|
||||
```javascript
|
||||
import { readable } from 'svelte/store';
|
||||
|
||||
// Convert RxJS observable to Svelte store
|
||||
function fromObservable(observable, initialValue) {
|
||||
return readable(initialValue, set => {
|
||||
const subscription = observable.subscribe(set);
|
||||
return () => subscription.unsubscribe();
|
||||
});
|
||||
}
|
||||
|
||||
// Usage
|
||||
const events$ = timeline.events$;
|
||||
const eventsStore = fromObservable(events$, []);
|
||||
```
|
||||
|
||||
```svelte
|
||||
<script>
|
||||
import { eventsStore } from './stores.js';
|
||||
</script>
|
||||
|
||||
{#each $eventsStore as event}
|
||||
<div>{event.content}</div>
|
||||
{/each}
|
||||
```
|
||||
|
||||
## Best Practices
|
||||
|
||||
### Store Management
|
||||
|
||||
1. **Single store instance** - Use one EventStore per app
|
||||
2. **Clear stale data** - Implement cache limits
|
||||
3. **Handle replaceable events** - Let store manage deduplication
|
||||
4. **Unsubscribe** - Clean up subscriptions on component destroy
|
||||
|
||||
### Query Optimization
|
||||
|
||||
1. **Use specific filters** - Narrow queries perform better
|
||||
2. **Limit results** - Use limit for initial loads
|
||||
3. **Cache queries** - Reuse query instances
|
||||
4. **Debounce updates** - Throttle rapid changes
|
||||
|
||||
### Memory Management
|
||||
|
||||
1. **Limit store size** - Implement LRU or time-based eviction
|
||||
2. **Clean up observables** - Unsubscribe when done
|
||||
3. **Use weak references** - For profile caches
|
||||
4. **Paginate large feeds** - Don't load everything at once
|
||||
|
||||
### Reactive Patterns
|
||||
|
||||
1. **Prefer observables** - Over imperative queries
|
||||
2. **Use operators** - Transform data with RxJS
|
||||
3. **Combine streams** - For complex views
|
||||
4. **Handle loading states** - Show placeholders
|
||||
|
||||
## Common Patterns
|
||||
|
||||
### Event Deduplication
|
||||
|
||||
```javascript
|
||||
// EventStore handles deduplication automatically
|
||||
eventStore.add(event1);
|
||||
eventStore.add(event1); // No duplicate
|
||||
|
||||
// For manual deduplication
|
||||
const seen = new Set();
|
||||
events.filter(e => {
|
||||
if (seen.has(e.id)) return false;
|
||||
seen.add(e.id);
|
||||
return true;
|
||||
});
|
||||
```
|
||||
|
||||
### Optimistic Updates
|
||||
|
||||
```javascript
|
||||
async function publishNote(content) {
|
||||
// Create event
|
||||
const event = await createEvent(content);
|
||||
|
||||
// Add to store immediately (optimistic)
|
||||
eventStore.add(event);
|
||||
|
||||
try {
|
||||
// Publish to relays
|
||||
await pool.publish(relays, event);
|
||||
} catch (error) {
|
||||
// Remove on failure
|
||||
eventStore.remove(event.id);
|
||||
throw error;
|
||||
}
|
||||
}
|
||||
```
|
||||
|
||||
### Loading States
|
||||
|
||||
```javascript
|
||||
import { BehaviorSubject, combineLatest } from 'rxjs';
|
||||
|
||||
const loading$ = new BehaviorSubject(true);
|
||||
const events$ = timeline.events$;
|
||||
|
||||
const state$ = combineLatest([loading$, events$]).pipe(
|
||||
map(([loading, events]) => ({
|
||||
loading,
|
||||
events,
|
||||
empty: !loading && events.length === 0
|
||||
}))
|
||||
);
|
||||
|
||||
// Start loading
|
||||
loading$.next(true);
|
||||
await loadEvents();
|
||||
loading$.next(false);
|
||||
```
|
||||
|
||||
### Infinite Scroll
|
||||
|
||||
```javascript
|
||||
function createInfiniteScroll(timeline, pageSize = 50) {
|
||||
let loading = false;
|
||||
|
||||
async function loadMore() {
|
||||
if (loading) return;
|
||||
|
||||
loading = true;
|
||||
await timeline.loadMore(pageSize);
|
||||
loading = false;
|
||||
}
|
||||
|
||||
function onScroll(event) {
|
||||
const { scrollTop, scrollHeight, clientHeight } = event.target;
|
||||
if (scrollHeight - scrollTop <= clientHeight * 1.5) {
|
||||
loadMore();
|
||||
}
|
||||
}
|
||||
|
||||
return { loadMore, onScroll };
|
||||
}
|
||||
```
|
||||
|
||||
## Troubleshooting
|
||||
|
||||
### Common Issues
|
||||
|
||||
**Events not updating:**
|
||||
- Check subscription is active
|
||||
- Verify events are being added to store
|
||||
- Ensure filter matches events
|
||||
|
||||
**Memory growing:**
|
||||
- Implement store size limits
|
||||
- Clean up subscriptions
|
||||
- Use weak references where appropriate
|
||||
|
||||
**Slow queries:**
|
||||
- Add indexes for common queries
|
||||
- Use more specific filters
|
||||
- Implement pagination
|
||||
|
||||
**Stale data:**
|
||||
- Implement refresh mechanisms
|
||||
- Set up real-time subscriptions
|
||||
- Handle replaceable event updates
|
||||
|
||||
## References
|
||||
|
||||
- **applesauce GitHub**: https://github.com/hzrd149/applesauce
|
||||
- **RxJS Documentation**: https://rxjs.dev
|
||||
- **nostr-tools**: https://github.com/nbd-wtf/nostr-tools
|
||||
- **Nostr Protocol**: https://github.com/nostr-protocol/nostr
|
||||
|
||||
## Related Skills
|
||||
|
||||
- **nostr-tools** - Lower-level Nostr operations
|
||||
- **applesauce-signers** - Event signing abstractions
|
||||
- **svelte** - Building reactive UIs
|
||||
- **nostr** - Nostr protocol fundamentals
|
||||
Reference in New Issue
Block a user